C26H25FN4O7 — CID 91032847
(4S,4aS,5aR,12aS)-9-amino-4-(dimethylamino)-8-(6-fluoro-3-pyridinyl)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91032847) has the molecular formula C26H25FN4O7 and a molecular weight of 524.51 g/mol. Its IUPAC name is (4S,4aS,5aR,12aS)-9-amino-4-(dimethylamino)-8-(6-fluoro-3-pyridinyl)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aS)-9-amino-4-(dimethylamino)-8-(6-fluoro-3-pyridinyl)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91032847 |
| Molecular Formula | C26H25FN4O7 |
| Molecular Weight | 524.51 g/mol |
| Exact Mass | 524.17 |
| IUPAC Name | (4S,4aS,5aR,12aS)-9-amino-4-(dimethylamino)-8-(6-fluoro-3-pyridinyl)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)C(=O)[C@@]2(O)C(=O)C3C(=O)c4c(cc(-c5ccc(F)nc5)c(N)c4O)C[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C26H25FN4O7/c1-31(2)19-13-7-11-5-10-6-12(9-3-4-14(27)30-8-9)18(28)21(33)15(10)20(32)16(11)23(35)26(13,38)24(36)17(22(19)34)25(29)37/h3-4,6,8,11,13,16-17,19,33,38H,5,7,28H2,1-2H3,(H2,29,37)/t11-,13-,16?,17?,19-,26-/m0/s1 |
| InChIKey | WHCJFTRDZNPIAM-KYFRJZSISA-N |
| XLogP | -0.35 |
| TPSA | 193.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.51 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|