C34H48O12 — CID 91033453
[5-acetyloxy-4-(acetyloxymethyl)-6,11-dihydroxy-8,12,15,15-tetramethyl-14-(2-methylbutanoyloxy)-7-oxo-3-oxapentacyclo[9.5.0.02,4.06,10.014,16]hexadec-9-en-13-yl] 2-methylbutanoate (PubChem CID 91033453) has the molecular formula C34H48O12 and a molecular weight of 648.75 g/mol. Its IUPAC name is [5-acetyloxy-4-(acetyloxymethyl)-6,11-dihydroxy-8,12,15,15-tetramethyl-14-(2-methylbutanoyloxy)-7-oxo-3-oxapentacyclo[9.5.0.02,4.06,10.014,16]hexadec-9-en-13-yl] 2-methylbutanoate.
| Compound Name | [5-acetyloxy-4-(acetyloxymethyl)-6,11-dihydroxy-8,12,15,15-tetramethyl-14-(2-methylbutanoyloxy)-7-oxo-3-oxapentacyclo[9.5.0.02,4.06,10.014,16]hexadec-9-en-13-yl] 2-methylbutanoate |
|---|---|
| PubChem CID | 91033453 |
| Molecular Formula | C34H48O12 |
| Molecular Weight | 648.75 g/mol |
| Exact Mass | 648.31 |
| IUPAC Name | [5-acetyloxy-4-(acetyloxymethyl)-6,11-dihydroxy-8,12,15,15-tetramethyl-14-(2-methylbutanoyloxy)-7-oxo-3-oxapentacyclo[9.5.0.02,4.06,10.014,16]hexadec-9-en-13-yl] 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OC1C(C)C2(O)C3=CC(C)C(=O)C3(O)C(OC(C)=O)C3(COC(C)=O)OC3C2C2C(C)(C)C12OC(=O)C(C)CC |
| InChI | InChI=1S/C34H48O12/c1-11-15(3)27(38)44-25-18(6)32(40)21-13-17(5)24(37)33(21,41)29(43-20(8)36)31(14-42-19(7)35)26(45-31)22(32)23-30(9,10)34(23,25)46-28(39)16(4)12-2/h13,15-18,22-23,25-26,29,40-41H,11-12,14H2,1-10H3 |
| InChIKey | RJCUCZTWGHBLGN-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 175.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.75 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|