About 1,2-ditert-butyl-4-methyl-2,3-dihydro-1H-inden-5-ol
1,2-ditert-butyl-4-methyl-2,3-dihydro-1H-inden-5-ol (PubChem CID 91033479) has the molecular formula C18H28O
and a molecular weight of 260.42 g/mol. Its IUPAC name is 1,2-ditert-butyl-4-methyl-2,3-dihydro-1H-inden-5-ol.
Molecular Properties
| Compound Name | 1,2-ditert-butyl-4-methyl-2,3-dihydro-1H-inden-5-ol |
| PubChem CID | 91033479 |
| Molecular Formula | C18H28O |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.21 |
| IUPAC Name | 1,2-ditert-butyl-4-methyl-2,3-dihydro-1H-inden-5-ol |
| SMILES | Cc1c(O)ccc2c1CC(C(C)(C)C)C2C(C)(C)C |
| InChI | InChI=1S/C18H28O/c1-11-13-10-14(17(2,3)4)16(18(5,6)7)12(13)8-9-15(11)19/h8-9,14,16,19H,10H2,1-7H3 |
| InChIKey | NXUJDQUMRMUULH-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,2-ditert-butyl-4-methyl-2,3-dihydro-1H-inden-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-ditert-butyl-4-methyl-2,3-dihydro-1H-inden-5-ol?
The IUPAC name of 1,2-ditert-butyl-4-methyl-2,3-dihydro-1H-inden-5-ol (CID 91033479) is 1,2-ditert-butyl-4-methyl-2,3-dihydro-1H-inden-5-ol.
What is the SMILES notation for 1,2-ditert-butyl-4-methyl-2,3-dihydro-1H-inden-5-ol?
The canonical SMILES for 1,2-ditert-butyl-4-methyl-2,3-dihydro-1H-inden-5-ol is Cc1c(O)ccc2c1CC(C(C)(C)C)C2C(C)(C)C.
What is the InChIKey of 1,2-ditert-butyl-4-methyl-2,3-dihydro-1H-inden-5-ol?
The InChIKey is NXUJDQUMRMUULH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28O/c1-11-13-10-14(17(2,3)4)16(18(5,6)7)12(13)8-9-15(11)19/h8-9,14,16,19H,10H2,1-7H3.
What are the key properties of 1,2-ditert-butyl-4-methyl-2,3-dihydro-1H-inden-5-ol?
1,2-ditert-butyl-4-methyl-2,3-dihydro-1H-inden-5-ol has a molecular weight of 260.42 g/mol, XLogP of 5.05, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-ditert-butyl-4-methyl-2,3-dihydro-1H-inden-5-ol is sourced from PubChem (CID 91033479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).