C11H17NO — CID 91033710
2-[(4aS)-3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl]acetaldehyde (PubChem CID 91033710) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is 2-[(4aS)-3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl]acetaldehyde.
| Compound Name | 2-[(4aS)-3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl]acetaldehyde |
|---|---|
| PubChem CID | 91033710 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 2-[(4aS)-3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl]acetaldehyde |
| SMILES | O=CCN1CCC[C@@H]2CCCC=C21 |
| InChI | InChI=1S/C11H17NO/c13-9-8-12-7-3-5-10-4-1-2-6-11(10)12/h6,9-10H,1-5,7-8H2/t10-/m0/s1 |
| InChIKey | IGRFQEWHRHXYRP-JTQLQIEISA-N |
| XLogP | 1.97 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|