C24H24N2O10 — CID 91034045
(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl) 4-[(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)oxycarbonyloxy]butyl carbonate (PubChem CID 91034045) has the molecular formula C24H24N2O10 and a molecular weight of 500.46 g/mol. Its IUPAC name is (3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl) 4-[(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)oxycarbonyloxy]butyl carbonate.
| Compound Name | (3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl) 4-[(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)oxycarbonyloxy]butyl carbonate |
|---|---|
| PubChem CID | 91034045 |
| Molecular Formula | C24H24N2O10 |
| Molecular Weight | 500.46 g/mol |
| Exact Mass | 500.14 |
| IUPAC Name | (3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl) 4-[(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)oxycarbonyloxy]butyl carbonate |
| SMILES | O=C(OCCCCOC(=O)On1c(O)c2c(c1O)C1C=CC2C1)On1c(O)c2c(c1O)C1C=CC2C1 |
| InChI | InChI=1S/C24H24N2O10/c27-19-15-11-3-4-12(9-11)16(15)20(28)25(19)35-23(31)33-7-1-2-8-34-24(32)36-26-21(29)17-13-5-6-14(10-13)18(17)22(26)30/h3-6,11-14,27-30H,1-2,7-10H2 |
| InChIKey | PWAYYOALSOXQLB-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 161.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.46 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|