C26H38S9Si — CID 91034933
bis(sulfanylidene)-tritio-tritiosulfanylsulfinothioyl-λ6-sulfane;7,7-dihexyl-4-methyl-10-(5-methylthiophen-2-yl)-3,11-dithia-7-silatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene (PubChem CID 91034933) has the molecular formula C26H38S9Si and a molecular weight of 671.30 g/mol. Its IUPAC name is bis(sulfanylidene)-tritio-tritiosulfanylsulfinothioyl-λ6-sulfane;7,7-dihexyl-4-methyl-10-(5-methylthiophen-2-yl)-3,11-dithia-7-silatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene.
| Compound Name | bis(sulfanylidene)-tritio-tritiosulfanylsulfinothioyl-λ6-sulfane;7,7-dihexyl-4-methyl-10-(5-methylthiophen-2-yl)-3,11-dithia-7-silatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene |
|---|---|
| PubChem CID | 91034933 |
| Molecular Formula | C26H38S9Si |
| Molecular Weight | 671.30 g/mol |
| Exact Mass | 670.04 |
| IUPAC Name | bis(sulfanylidene)-tritio-tritiosulfanylsulfinothioyl-λ6-sulfane;7,7-dihexyl-4-methyl-10-(5-methylthiophen-2-yl)-3,11-dithia-7-silatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene |
| SMILES | CCCCCC[Si]1(CCCCCC)c2cc(C)sc2-c2sc(-c3ccc(C)s3)cc21.[3H]SS(=S)S([3H])(=S)=S |
| InChI | InChI=1S/C26H36S3Si.H2S6/c1-5-7-9-11-15-30(16-12-10-8-6-2)23-17-20(4)28-25(23)26-24(30)18-22(29-26)21-14-13-19(3)27-21;1-5(2)6(3)4/h13-14,17-18H,5-12,15-16H2,1-4H3;5H,(H,3,4)/i;5T/hT |
| InChIKey | VHXZKDNILAQGQV-XJAVQSICSA-N |
| XLogP | 8.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.30 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|