About 9-fluoro-6-methylundeca-7,9-dien-3-amine
9-fluoro-6-methylundeca-7,9-dien-3-amine (PubChem CID 91034943) has the molecular formula C12H22FN
and a molecular weight of 199.31 g/mol. Its IUPAC name is 9-fluoro-6-methylundeca-7,9-dien-3-amine.
Molecular Properties
| Compound Name | 9-fluoro-6-methylundeca-7,9-dien-3-amine |
| PubChem CID | 91034943 |
| Molecular Formula | C12H22FN |
| Molecular Weight | 199.31 g/mol |
| Exact Mass | 199.17 |
| IUPAC Name | 9-fluoro-6-methylundeca-7,9-dien-3-amine |
| SMILES | CC=C(F)C=CC(C)CCC(N)CC |
| InChI | InChI=1S/C12H22FN/c1-4-11(13)8-6-10(3)7-9-12(14)5-2/h4,6,8,10,12H,5,7,9,14H2,1-3H3 |
| InChIKey | AJHLZGARXRJZPH-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.31 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 9-fluoro-6-methylundeca-7,9-dien-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-fluoro-6-methylundeca-7,9-dien-3-amine?
The IUPAC name of 9-fluoro-6-methylundeca-7,9-dien-3-amine (CID 91034943) is 9-fluoro-6-methylundeca-7,9-dien-3-amine.
What is the SMILES notation for 9-fluoro-6-methylundeca-7,9-dien-3-amine?
The canonical SMILES for 9-fluoro-6-methylundeca-7,9-dien-3-amine is CC=C(F)C=CC(C)CCC(N)CC.
What is the InChIKey of 9-fluoro-6-methylundeca-7,9-dien-3-amine?
The InChIKey is AJHLZGARXRJZPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22FN/c1-4-11(13)8-6-10(3)7-9-12(14)5-2/h4,6,8,10,12H,5,7,9,14H2,1-3H3.
What are the key properties of 9-fluoro-6-methylundeca-7,9-dien-3-amine?
9-fluoro-6-methylundeca-7,9-dien-3-amine has a molecular weight of 199.31 g/mol, XLogP of 3.57, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9-fluoro-6-methylundeca-7,9-dien-3-amine is sourced from PubChem (CID 91034943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).