C33H66N2+2 — CID 91034990
2-[(6,6-dimethyl-4-propylheptan-3-yl)-ethylamino]ethyl-[(E,5Z)-5-ethylidene-2,3-dimethylundec-9-enyl]-dimethylazanium (PubChem CID 91034990) has the molecular formula C33H66N2+2 and a molecular weight of 490.91 g/mol. Its IUPAC name is 2-[(6,6-dimethyl-4-propylheptan-3-yl)-ethylamino]ethyl-[(E,5Z)-5-ethylidene-2,3-dimethylundec-9-enyl]-dimethylazanium.
| Compound Name | 2-[(6,6-dimethyl-4-propylheptan-3-yl)-ethylamino]ethyl-[(E,5Z)-5-ethylidene-2,3-dimethylundec-9-enyl]-dimethylazanium |
|---|---|
| PubChem CID | 91034990 |
| Molecular Formula | C33H66N2+2 |
| Molecular Weight | 490.91 g/mol |
| Exact Mass | 490.52 |
| IUPAC Name | 2-[(6,6-dimethyl-4-propylheptan-3-yl)-ethylamino]ethyl-[(E,5Z)-5-ethylidene-2,3-dimethylundec-9-enyl]-dimethylazanium |
| SMILES | C/C=C(/CCC/C=C/C)CC(C)C(C)C[N+](C)(C)CCN(CC)C(CC)[C+](CCC)CC(C)(C)C |
| InChI | InChI=1S/C33H66N2/c1-13-18-19-20-22-30(15-3)25-28(6)29(7)27-35(11,12)24-23-34(17-5)32(16-4)31(21-14-2)26-33(8,9)10/h13,15,18,28-29,32H,14,16-17,19-27H2,1-12H3/q+2/b18-13+,30-15- |
| InChIKey | VKQSZLPSSNGLEC-FHCOLMTNSA-N |
| XLogP | 9.33 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.91 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|