C12H13NO4S — CID 91035070
1,3,3a,4,5,8b-hexahydrothieno[3,2-e]isoindole-2,8-dicarboxylic acid (PubChem CID 91035070) has the molecular formula C12H13NO4S and a molecular weight of 267.31 g/mol. Its IUPAC name is 1,3,3a,4,5,8b-hexahydrothieno[3,2-e]isoindole-2,8-dicarboxylic acid.
| Compound Name | 1,3,3a,4,5,8b-hexahydrothieno[3,2-e]isoindole-2,8-dicarboxylic acid |
|---|---|
| PubChem CID | 91035070 |
| Molecular Formula | C12H13NO4S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 1,3,3a,4,5,8b-hexahydrothieno[3,2-e]isoindole-2,8-dicarboxylic acid |
| SMILES | O=C(O)c1csc2c1C1CN(C(=O)O)CC1CC2 |
| InChI | InChI=1S/C12H13NO4S/c14-11(15)8-5-18-9-2-1-6-3-13(12(16)17)4-7(6)10(8)9/h5-7H,1-4H2,(H,14,15)(H,16,17) |
| InChIKey | MEVZHYQRVZMXIE-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |