C8H7F5N2O3S — CID 91035290
1-[2-(1,1,2,2,2-pentafluoroethyl)-1,3-thiazol-4-yl]propan-2-yl nitrate (PubChem CID 91035290) has the molecular formula C8H7F5N2O3S and a molecular weight of 306.21 g/mol. Its IUPAC name is 1-[2-(1,1,2,2,2-pentafluoroethyl)-1,3-thiazol-4-yl]propan-2-yl nitrate.
| Compound Name | 1-[2-(1,1,2,2,2-pentafluoroethyl)-1,3-thiazol-4-yl]propan-2-yl nitrate |
|---|---|
| PubChem CID | 91035290 |
| Molecular Formula | C8H7F5N2O3S |
| Molecular Weight | 306.21 g/mol |
| Exact Mass | 306.01 |
| IUPAC Name | 1-[2-(1,1,2,2,2-pentafluoroethyl)-1,3-thiazol-4-yl]propan-2-yl nitrate |
| SMILES | CC(Cc1csc(C(F)(F)C(F)(F)F)n1)O[N+](=O)[O-] |
| InChI | InChI=1S/C8H7F5N2O3S/c1-4(18-15(16)17)2-5-3-19-6(14-5)7(9,10)8(11,12)13/h3-4H,2H2,1H3 |
| InChIKey | UBUIDNRJIZTART-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 65.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.21 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|