C22H14F17NO5 — CID 91035398
(2,5-dihydroxypyrrol-1-yl) [4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)phenyl]methyl carbonate (PubChem CID 91035398) has the molecular formula C22H14F17NO5 and a molecular weight of 695.32 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) [4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)phenyl]methyl carbonate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) [4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)phenyl]methyl carbonate |
|---|---|
| PubChem CID | 91035398 |
| Molecular Formula | C22H14F17NO5 |
| Molecular Weight | 695.32 g/mol |
| Exact Mass | 695.06 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) [4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)phenyl]methyl carbonate |
| SMILES | O=C(OCc1ccc(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1)On1c(O)ccc1O |
| InChI | InChI=1S/C22H14F17NO5/c23-15(24,8-7-10-1-3-11(4-2-10)9-44-14(43)45-40-12(41)5-6-13(40)42)16(25,26)17(27,28)18(29,30)19(31,32)20(33,34)21(35,36)22(37,38)39/h1-6,41-42H,7-9H2 |
| InChIKey | OFEUETVRIFNHTN-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.32 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|