About (E)-6-bromohept-5-ene-3,4-diimine
(E)-6-bromohept-5-ene-3,4-diimine (PubChem CID 91036194) has the molecular formula C7H11BrN2
and a molecular weight of 203.08 g/mol. Its IUPAC name is (E)-6-bromohept-5-ene-3,4-diimine.
Molecular Properties
| Compound Name | (E)-6-bromohept-5-ene-3,4-diimine |
| PubChem CID | 91036194 |
| Molecular Formula | C7H11BrN2 |
| Molecular Weight | 203.08 g/mol |
| Exact Mass | 202.01 |
| IUPAC Name | (E)-6-bromohept-5-ene-3,4-diimine |
| SMILES | [H]/N=C(/C=C(\C)Br)C(\CC)=N\[H] |
| InChI | InChI=1S/C7H11BrN2/c1-3-6(9)7(10)4-5(2)8/h4,9-10H,3H2,1-2H3/b5-4+,9-6+,10-7- |
| InChIKey | JLJPUAJLZBUKQH-HSUNBIQVSA-N |
| XLogP | 2.73 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.08 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-6-bromohept-5-ene-3,4-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-6-bromohept-5-ene-3,4-diimine?
The IUPAC name of (E)-6-bromohept-5-ene-3,4-diimine (CID 91036194) is (E)-6-bromohept-5-ene-3,4-diimine.
What is the SMILES notation for (E)-6-bromohept-5-ene-3,4-diimine?
The canonical SMILES for (E)-6-bromohept-5-ene-3,4-diimine is [H]/N=C(/C=C(\C)Br)C(\CC)=N\[H].
What is the InChIKey of (E)-6-bromohept-5-ene-3,4-diimine?
The InChIKey is JLJPUAJLZBUKQH-HSUNBIQVSA-N. The full InChI is InChI=1S/C7H11BrN2/c1-3-6(9)7(10)4-5(2)8/h4,9-10H,3H2,1-2H3/b5-4+,9-6+,10-7-.
What are the key properties of (E)-6-bromohept-5-ene-3,4-diimine?
(E)-6-bromohept-5-ene-3,4-diimine has a molecular weight of 203.08 g/mol, XLogP of 2.73, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-6-bromohept-5-ene-3,4-diimine is sourced from PubChem (CID 91036194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).