About 9-(5-chloropentyl)-2,8-dimethylpurin-6-amine
9-(5-chloropentyl)-2,8-dimethylpurin-6-amine (PubChem CID 91036513) has the molecular formula C12H18ClN5
and a molecular weight of 267.76 g/mol. Its IUPAC name is 9-(5-chloropentyl)-2,8-dimethylpurin-6-amine.
Molecular Properties
| Compound Name | 9-(5-chloropentyl)-2,8-dimethylpurin-6-amine |
| PubChem CID | 91036513 |
| Molecular Formula | C12H18ClN5 |
| Molecular Weight | 267.76 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 9-(5-chloropentyl)-2,8-dimethylpurin-6-amine |
| SMILES | Cc1nc(N)c2nc(C)n(CCCCCCl)c2n1 |
| InChI | InChI=1S/C12H18ClN5/c1-8-15-11(14)10-12(16-8)18(9(2)17-10)7-5-3-4-6-13/h3-7H2,1-2H3,(H2,14,15,16) |
| InChIKey | ZVTTVEUWNVJBMO-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.76 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 9-(5-chloropentyl)-2,8-dimethylpurin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(5-chloropentyl)-2,8-dimethylpurin-6-amine?
The IUPAC name of 9-(5-chloropentyl)-2,8-dimethylpurin-6-amine (CID 91036513) is 9-(5-chloropentyl)-2,8-dimethylpurin-6-amine.
What is the SMILES notation for 9-(5-chloropentyl)-2,8-dimethylpurin-6-amine?
The canonical SMILES for 9-(5-chloropentyl)-2,8-dimethylpurin-6-amine is Cc1nc(N)c2nc(C)n(CCCCCCl)c2n1.
What is the InChIKey of 9-(5-chloropentyl)-2,8-dimethylpurin-6-amine?
The InChIKey is ZVTTVEUWNVJBMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18ClN5/c1-8-15-11(14)10-12(16-8)18(9(2)17-10)7-5-3-4-6-13/h3-7H2,1-2H3,(H2,14,15,16).
What are the key properties of 9-(5-chloropentyl)-2,8-dimethylpurin-6-amine?
9-(5-chloropentyl)-2,8-dimethylpurin-6-amine has a molecular weight of 267.76 g/mol, XLogP of 2.43, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(5-chloropentyl)-2,8-dimethylpurin-6-amine is sourced from PubChem (CID 91036513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).