C14H19FN2OS2 — CID 9103670
[(2R)-1-[[(1R)-1-(4-fluorophenyl)ethyl]amino]-1-oxopropan-2-yl] N,N-dimethylcarbamodithioate (PubChem CID 9103670) has the molecular formula C14H19FN2OS2 and a molecular weight of 314.45 g/mol. Its IUPAC name is [(2R)-1-[[(1R)-1-(4-fluorophenyl)ethyl]amino]-1-oxopropan-2-yl] N,N-dimethylcarbamodithioate.
| Compound Name | [(2R)-1-[[(1R)-1-(4-fluorophenyl)ethyl]amino]-1-oxopropan-2-yl] N,N-dimethylcarbamodithioate |
|---|---|
| PubChem CID | 9103670 |
| Molecular Formula | C14H19FN2OS2 |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | [(2R)-1-[[(1R)-1-(4-fluorophenyl)ethyl]amino]-1-oxopropan-2-yl] N,N-dimethylcarbamodithioate |
| SMILES | C[C@@H](SC(=S)N(C)C)C(=O)N[C@H](C)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H19FN2OS2/c1-9(11-5-7-12(15)8-6-11)16-13(18)10(2)20-14(19)17(3)4/h5-10H,1-4H3,(H,16,18)/t9-,10-/m1/s1 |
| InChIKey | QLABZVIUOLFPNH-NXEZZACHSA-N |
| XLogP | 2.97 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|