C19H28N5+ — CID 91036933
(3S,5R)-1-methyl-1-phenyl-4-[(pyridin-2-ylmethylamino)methyl]piperidin-1-ium-3,5-diamine (PubChem CID 91036933) has the molecular formula C19H28N5+ and a molecular weight of 326.47 g/mol. Its IUPAC name is (3S,5R)-1-methyl-1-phenyl-4-[(pyridin-2-ylmethylamino)methyl]piperidin-1-ium-3,5-diamine.
| Compound Name | (3S,5R)-1-methyl-1-phenyl-4-[(pyridin-2-ylmethylamino)methyl]piperidin-1-ium-3,5-diamine |
|---|---|
| PubChem CID | 91036933 |
| Molecular Formula | C19H28N5+ |
| Molecular Weight | 326.47 g/mol |
| Exact Mass | 326.23 |
| IUPAC Name | (3S,5R)-1-methyl-1-phenyl-4-[(pyridin-2-ylmethylamino)methyl]piperidin-1-ium-3,5-diamine |
| SMILES | C[N+]1(c2ccccc2)C[C@@H](N)C(CNCc2ccccn2)[C@@H](N)C1 |
| InChI | InChI=1S/C19H28N5/c1-24(16-8-3-2-4-9-16)13-18(20)17(19(21)14-24)12-22-11-15-7-5-6-10-23-15/h2-10,17-19,22H,11-14,20-21H2,1H3/q+1/t17?,18-,19+,24? |
| InChIKey | XXVVRLZKQVIWIL-JHFJLTJKSA-N |
| XLogP | 1.09 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.47 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|