C26H24F3NO6 — CID 91037432
2,2,2-trifluoroethyl 2-[2,5-dihydroxy-4-methyl-1-[4-(3-phenylprop-2-enoyloxy)phenyl]pyrrol-3-yl]butanoate (PubChem CID 91037432) has the molecular formula C26H24F3NO6 and a molecular weight of 503.47 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 2-[2,5-dihydroxy-4-methyl-1-[4-(3-phenylprop-2-enoyloxy)phenyl]pyrrol-3-yl]butanoate.
| Compound Name | 2,2,2-trifluoroethyl 2-[2,5-dihydroxy-4-methyl-1-[4-(3-phenylprop-2-enoyloxy)phenyl]pyrrol-3-yl]butanoate |
|---|---|
| PubChem CID | 91037432 |
| Molecular Formula | C26H24F3NO6 |
| Molecular Weight | 503.47 g/mol |
| Exact Mass | 503.16 |
| IUPAC Name | 2,2,2-trifluoroethyl 2-[2,5-dihydroxy-4-methyl-1-[4-(3-phenylprop-2-enoyloxy)phenyl]pyrrol-3-yl]butanoate |
| SMILES | CCC(C(=O)OCC(F)(F)F)c1c(C)c(O)n(-c2ccc(OC(=O)C=Cc3ccccc3)cc2)c1O |
| InChI | InChI=1S/C26H24F3NO6/c1-3-20(25(34)35-15-26(27,28)29)22-16(2)23(32)30(24(22)33)18-10-12-19(13-11-18)36-21(31)14-9-17-7-5-4-6-8-17/h4-14,20,32-33H,3,15H2,1-2H3 |
| InChIKey | JBMPLAKYIHOCBQ-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.47 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|