C18H25FN2O — CID 91037773
1-[(1S,3S)-3-(4-fluorophenyl)-8-methyl-8-azabicyclo[3.2.1]octan-2-ylidene]-N-methoxypropan-1-amine (PubChem CID 91037773) has the molecular formula C18H25FN2O and a molecular weight of 304.41 g/mol. Its IUPAC name is 1-[(1S,3S)-3-(4-fluorophenyl)-8-methyl-8-azabicyclo[3.2.1]octan-2-ylidene]-N-methoxypropan-1-amine.
| Compound Name | 1-[(1S,3S)-3-(4-fluorophenyl)-8-methyl-8-azabicyclo[3.2.1]octan-2-ylidene]-N-methoxypropan-1-amine |
|---|---|
| PubChem CID | 91037773 |
| Molecular Formula | C18H25FN2O |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | 1-[(1S,3S)-3-(4-fluorophenyl)-8-methyl-8-azabicyclo[3.2.1]octan-2-ylidene]-N-methoxypropan-1-amine |
| SMILES | CCC(NOC)=C1[C@H](c2ccc(F)cc2)CC2CC[C@@H]1N2C |
| InChI | InChI=1S/C18H25FN2O/c1-4-16(20-22-3)18-15(12-5-7-13(19)8-6-12)11-14-9-10-17(18)21(14)2/h5-8,14-15,17,20H,4,9-11H2,1-3H3/t14?,15-,17-/m0/s1 |
| InChIKey | CDSZDADJEMJPDM-ZWBSKUQPSA-N |
| XLogP | 3.59 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|