About 1-(6-amino-6,7-dihydropurin-1-yl)propan-2-ol
1-(6-amino-6,7-dihydropurin-1-yl)propan-2-ol (PubChem CID 91038077) has the molecular formula C8H13N5O
and a molecular weight of 195.23 g/mol. Its IUPAC name is 1-(6-amino-6,7-dihydropurin-1-yl)propan-2-ol.
Molecular Properties
| Compound Name | 1-(6-amino-6,7-dihydropurin-1-yl)propan-2-ol |
| PubChem CID | 91038077 |
| Molecular Formula | C8H13N5O |
| Molecular Weight | 195.23 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | 1-(6-amino-6,7-dihydropurin-1-yl)propan-2-ol |
| SMILES | CC(O)CN1C=Nc2nc[nH]c2C1N |
| InChI | InChI=1S/C8H13N5O/c1-5(14)2-13-4-12-8-6(7(13)9)10-3-11-8/h3-5,7,14H,2,9H2,1H3,(H,10,11) |
| InChIKey | AITVYMAHJTVUIH-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 90.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.23 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(6-amino-6,7-dihydropurin-1-yl)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-amino-6,7-dihydropurin-1-yl)propan-2-ol?
The IUPAC name of 1-(6-amino-6,7-dihydropurin-1-yl)propan-2-ol (CID 91038077) is 1-(6-amino-6,7-dihydropurin-1-yl)propan-2-ol.
What is the SMILES notation for 1-(6-amino-6,7-dihydropurin-1-yl)propan-2-ol?
The canonical SMILES for 1-(6-amino-6,7-dihydropurin-1-yl)propan-2-ol is CC(O)CN1C=Nc2nc[nH]c2C1N.
What is the InChIKey of 1-(6-amino-6,7-dihydropurin-1-yl)propan-2-ol?
The InChIKey is AITVYMAHJTVUIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N5O/c1-5(14)2-13-4-12-8-6(7(13)9)10-3-11-8/h3-5,7,14H,2,9H2,1H3,(H,10,11).
What are the key properties of 1-(6-amino-6,7-dihydropurin-1-yl)propan-2-ol?
1-(6-amino-6,7-dihydropurin-1-yl)propan-2-ol has a molecular weight of 195.23 g/mol, XLogP of -0.28, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-amino-6,7-dihydropurin-1-yl)propan-2-ol is sourced from PubChem (CID 91038077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).