C9H8N2O4 — CID 91038203
2,3-dihydropyrrolo[2,3-b]pyridine-1,2-dicarboxylic acid (PubChem CID 91038203) has the molecular formula C9H8N2O4 and a molecular weight of 208.17 g/mol. Its IUPAC name is 2,3-dihydropyrrolo[2,3-b]pyridine-1,2-dicarboxylic acid.
| Compound Name | 2,3-dihydropyrrolo[2,3-b]pyridine-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 91038203 |
| Molecular Formula | C9H8N2O4 |
| Molecular Weight | 208.17 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | 2,3-dihydropyrrolo[2,3-b]pyridine-1,2-dicarboxylic acid |
| SMILES | O=C(O)C1Cc2cccnc2N1C(=O)O |
| InChI | InChI=1S/C9H8N2O4/c12-8(13)6-4-5-2-1-3-10-7(5)11(6)9(14)15/h1-3,6H,4H2,(H,12,13)(H,14,15) |
| InChIKey | FVVUGWRBMJTLRZ-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 90.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.17 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |