C26H54O6Si2 — CID 91038249
(1R,2S)-1-[(2R,3S,4S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-[(2S)-1-hydroxybut-3-en-2-yl]-2-methyloxolan-2-yl]-2-methylpropane-1,3-diol (PubChem CID 91038249) has the molecular formula C26H54O6Si2 and a molecular weight of 518.88 g/mol. Its IUPAC name is (1R,2S)-1-[(2R,3S,4S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-[(2S)-1-hydroxybut-3-en-2-yl]-2-methyloxolan-2-yl]-2-methylpropane-1,3-diol.
| Compound Name | (1R,2S)-1-[(2R,3S,4S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-[(2S)-1-hydroxybut-3-en-2-yl]-2-methyloxolan-2-yl]-2-methylpropane-1,3-diol |
|---|---|
| PubChem CID | 91038249 |
| Molecular Formula | C26H54O6Si2 |
| Molecular Weight | 518.88 g/mol |
| Exact Mass | 518.35 |
| IUPAC Name | (1R,2S)-1-[(2R,3S,4S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-[(2S)-1-hydroxybut-3-en-2-yl]-2-methyloxolan-2-yl]-2-methylpropane-1,3-diol |
| SMILES | C=C[C@@H](CO)[C@H]1O[C@](C)([C@H](O)[C@@H](C)CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H54O6Si2/c1-14-19(16-28)21-20(17-30-33(10,11)24(3,4)5)23(32-34(12,13)25(6,7)8)26(9,31-21)22(29)18(2)15-27/h14,18-23,27-29H,1,15-17H2,2-13H3/t18-,19-,20-,21+,22+,23-,26+/m0/s1 |
| InChIKey | LKQUKPSISLHPCB-FQRNHCLKSA-N |
| XLogP | 4.96 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.88 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|