C18H15N7O — CID 91038379
[1-(3-methoxyphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]-(pyridin-4-ylmethyl)diazene (PubChem CID 91038379) has the molecular formula C18H15N7O and a molecular weight of 345.37 g/mol. Its IUPAC name is [1-(3-methoxyphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]-(pyridin-4-ylmethyl)diazene.
| Compound Name | [1-(3-methoxyphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]-(pyridin-4-ylmethyl)diazene |
|---|---|
| PubChem CID | 91038379 |
| Molecular Formula | C18H15N7O |
| Molecular Weight | 345.37 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | [1-(3-methoxyphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]-(pyridin-4-ylmethyl)diazene |
| SMILES | COc1cccc(-n2ncc3c(/N=N/Cc4ccncc4)ncnc32)c1 |
| InChI | InChI=1S/C18H15N7O/c1-26-15-4-2-3-14(9-15)25-18-16(11-23-25)17(20-12-21-18)24-22-10-13-5-7-19-8-6-13/h2-9,11-12H,10H2,1H3/b24-22+ |
| InChIKey | SAPYVGYEUFHIAF-ZNTNEXAZSA-N |
| XLogP | 3.50 |
| TPSA | 90.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.37 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|