C36H46F6Si — CID 91038915
dimethyl-bis[2-methyl-4-[2-(trifluoromethyl)phenyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]silane (PubChem CID 91038915) has the molecular formula C36H46F6Si and a molecular weight of 620.84 g/mol. Its IUPAC name is dimethyl-bis[2-methyl-4-[2-(trifluoromethyl)phenyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]silane.
| Compound Name | dimethyl-bis[2-methyl-4-[2-(trifluoromethyl)phenyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]silane |
|---|---|
| PubChem CID | 91038915 |
| Molecular Formula | C36H46F6Si |
| Molecular Weight | 620.84 g/mol |
| Exact Mass | 620.33 |
| IUPAC Name | dimethyl-bis[2-methyl-4-[2-(trifluoromethyl)phenyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]silane |
| SMILES | CC1CC2C(c3ccccc3C(F)(F)F)CCCC2C1[Si](C)(C)C1C(C)CC2C(c3ccccc3C(F)(F)F)CCCC21 |
| InChI | InChI=1S/C36H46F6Si/c1-21-19-29-23(25-11-5-7-17-31(25)35(37,38)39)13-9-15-27(29)33(21)43(3,4)34-22(2)20-30-24(14-10-16-28(30)34)26-12-6-8-18-32(26)36(40,41)42/h5-8,11-12,17-18,21-24,27-30,33-34H,9-10,13-16,19-20H2,1-4H3 |
| InChIKey | RZYBCEAJUQRABC-UHFFFAOYSA-N |
| XLogP | 11.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.84 |
| LogP ≤ 5 | 11.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|