C18H17N3O5 — CID 91039232
2-[[4-(dimethylamino)phenyl]methyl]-9-hydroxy-1,8-dioxopyrido[1,2-a]pyrazine-7-carboxylic acid (PubChem CID 91039232) has the molecular formula C18H17N3O5 and a molecular weight of 355.35 g/mol. Its IUPAC name is 2-[[4-(dimethylamino)phenyl]methyl]-9-hydroxy-1,8-dioxopyrido[1,2-a]pyrazine-7-carboxylic acid.
| Compound Name | 2-[[4-(dimethylamino)phenyl]methyl]-9-hydroxy-1,8-dioxopyrido[1,2-a]pyrazine-7-carboxylic acid |
|---|---|
| PubChem CID | 91039232 |
| Molecular Formula | C18H17N3O5 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 2-[[4-(dimethylamino)phenyl]methyl]-9-hydroxy-1,8-dioxopyrido[1,2-a]pyrazine-7-carboxylic acid |
| SMILES | CN(C)c1ccc(Cn2ccn3cc(C(=O)O)c(=O)c(O)c3c2=O)cc1 |
| InChI | InChI=1S/C18H17N3O5/c1-19(2)12-5-3-11(4-6-12)9-21-8-7-20-10-13(18(25)26)15(22)16(23)14(20)17(21)24/h3-8,10,23H,9H2,1-2H3,(H,25,26) |
| InChIKey | AHACAUJBMRKLFM-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 104.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|