About 3,4-dimethyl-N-(3-methyl-1,3-thiazol-2-ylidene)benzamide
3,4-dimethyl-N-(3-methyl-1,3-thiazol-2-ylidene)benzamide (PubChem CID 9103925) has the molecular formula C13H14N2OS
and a molecular weight of 246.33 g/mol. Its IUPAC name is 3,4-dimethyl-N-(3-methyl-1,3-thiazol-2-ylidene)benzamide.
Molecular Properties
| Compound Name | 3,4-dimethyl-N-(3-methyl-1,3-thiazol-2-ylidene)benzamide |
| PubChem CID | 9103925 |
| Molecular Formula | C13H14N2OS |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 3,4-dimethyl-N-(3-methyl-1,3-thiazol-2-ylidene)benzamide |
| SMILES | Cc1ccc(C(=O)/N=c2/sccn2C)cc1C |
| InChI | InChI=1S/C13H14N2OS/c1-9-4-5-11(8-10(9)2)12(16)14-13-15(3)6-7-17-13/h4-8H,1-3H3/b14-13+ |
| InChIKey | JGWXWJYCBSZHRO-BUHFOSPRSA-N |
| XLogP | 2.44 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,4-dimethyl-N-(3-methyl-1,3-thiazol-2-ylidene)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethyl-N-(3-methyl-1,3-thiazol-2-ylidene)benzamide?
The IUPAC name of 3,4-dimethyl-N-(3-methyl-1,3-thiazol-2-ylidene)benzamide (CID 9103925) is 3,4-dimethyl-N-(3-methyl-1,3-thiazol-2-ylidene)benzamide.
What is the SMILES notation for 3,4-dimethyl-N-(3-methyl-1,3-thiazol-2-ylidene)benzamide?
The canonical SMILES for 3,4-dimethyl-N-(3-methyl-1,3-thiazol-2-ylidene)benzamide is Cc1ccc(C(=O)/N=c2/sccn2C)cc1C.
What is the InChIKey of 3,4-dimethyl-N-(3-methyl-1,3-thiazol-2-ylidene)benzamide?
The InChIKey is JGWXWJYCBSZHRO-BUHFOSPRSA-N. The full InChI is InChI=1S/C13H14N2OS/c1-9-4-5-11(8-10(9)2)12(16)14-13-15(3)6-7-17-13/h4-8H,1-3H3/b14-13+.
What are the key properties of 3,4-dimethyl-N-(3-methyl-1,3-thiazol-2-ylidene)benzamide?
3,4-dimethyl-N-(3-methyl-1,3-thiazol-2-ylidene)benzamide has a molecular weight of 246.33 g/mol, XLogP of 2.44, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethyl-N-(3-methyl-1,3-thiazol-2-ylidene)benzamide is sourced from PubChem (CID 9103925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).