C25H23ClFN9O — CID 91039351
N-(3-chloro-5-methyl-4-pyrimidin-4-ylphenyl)-6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]pyridin-3-amine (PubChem CID 91039351) has the molecular formula C25H23ClFN9O and a molecular weight of 519.97 g/mol. Its IUPAC name is N-(3-chloro-5-methyl-4-pyrimidin-4-ylphenyl)-6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]pyridin-3-amine.
| Compound Name | N-(3-chloro-5-methyl-4-pyrimidin-4-ylphenyl)-6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]pyridin-3-amine |
|---|---|
| PubChem CID | 91039351 |
| Molecular Formula | C25H23ClFN9O |
| Molecular Weight | 519.97 g/mol |
| Exact Mass | 519.17 |
| IUPAC Name | N-(3-chloro-5-methyl-4-pyrimidin-4-ylphenyl)-6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]pyridin-3-amine |
| SMILES | Cc1cc(Nc2ccc(C/N=N/c3ncc(F)c(N4CCOCC4)n3)nc2)cc(Cl)c1-c1ccncn1 |
| InChI | InChI=1S/C25H23ClFN9O/c1-16-10-19(11-20(26)23(16)22-4-5-28-15-31-22)33-18-3-2-17(29-12-18)13-32-35-25-30-14-21(27)24(34-25)36-6-8-37-9-7-36/h2-5,10-12,14-15,33H,6-9,13H2,1H3/b35-32+ |
| InChIKey | XESNXHCLESNICC-LVYIWIAJSA-N |
| XLogP | 5.29 |
| TPSA | 113.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.97 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|