C29H46N2O3 — CID 91039593
(4S,5S,7S)-5-amino-N-butyl-4-hydroxy-2,7-dimethyl-3-[4-(propoxymethyl)naphthalen-2-yl]nonanamide (PubChem CID 91039593) has the molecular formula C29H46N2O3 and a molecular weight of 470.70 g/mol. Its IUPAC name is (4S,5S,7S)-5-amino-N-butyl-4-hydroxy-2,7-dimethyl-3-[4-(propoxymethyl)naphthalen-2-yl]nonanamide.
| Compound Name | (4S,5S,7S)-5-amino-N-butyl-4-hydroxy-2,7-dimethyl-3-[4-(propoxymethyl)naphthalen-2-yl]nonanamide |
|---|---|
| PubChem CID | 91039593 |
| Molecular Formula | C29H46N2O3 |
| Molecular Weight | 470.70 g/mol |
| Exact Mass | 470.35 |
| IUPAC Name | (4S,5S,7S)-5-amino-N-butyl-4-hydroxy-2,7-dimethyl-3-[4-(propoxymethyl)naphthalen-2-yl]nonanamide |
| SMILES | CCCCNC(=O)C(C)C(c1cc(COCCC)c2ccccc2c1)[C@H](O)[C@@H](N)C[C@@H](C)CC |
| InChI | InChI=1S/C29H46N2O3/c1-6-9-14-31-29(33)21(5)27(28(32)26(30)16-20(4)8-3)23-17-22-12-10-11-13-25(22)24(18-23)19-34-15-7-2/h10-13,17-18,20-21,26-28,32H,6-9,14-16,19,30H2,1-5H3,(H,31,33)/t20-,21?,26-,27?,28+/m0/s1 |
| InChIKey | FRTLDMUEOINDQQ-UOMFVWMTSA-N |
| XLogP | 5.53 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.70 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|