C13H30N4O3S4 — CID 91040116
1-[2,3-dihydroxy-1,4-bis(2-sulfanylethylamino)butyl]-1,3-bis(2-sulfanylethyl)urea (PubChem CID 91040116) has the molecular formula C13H30N4O3S4 and a molecular weight of 418.68 g/mol. Its IUPAC name is 1-[2,3-dihydroxy-1,4-bis(2-sulfanylethylamino)butyl]-1,3-bis(2-sulfanylethyl)urea.
| Compound Name | 1-[2,3-dihydroxy-1,4-bis(2-sulfanylethylamino)butyl]-1,3-bis(2-sulfanylethyl)urea |
|---|---|
| PubChem CID | 91040116 |
| Molecular Formula | C13H30N4O3S4 |
| Molecular Weight | 418.68 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | 1-[2,3-dihydroxy-1,4-bis(2-sulfanylethylamino)butyl]-1,3-bis(2-sulfanylethyl)urea |
| SMILES | O=C(NCCS)N(CCS)C(NCCS)C(O)C(O)CNCCS |
| InChI | InChI=1S/C13H30N4O3S4/c18-10(9-14-1-5-21)11(19)12(15-2-6-22)17(4-8-24)13(20)16-3-7-23/h10-12,14-15,18-19,21-24H,1-9H2,(H,16,20) |
| InChIKey | RLGGBXVNNUMZJP-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.68 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|