C29H32FN3O4S — CID 91040624
6-cyclopentyl-6-[2-(3-fluoro-4-propan-2-yloxyphenyl)ethyl]-3-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]oxane-2,4-dione (PubChem CID 91040624) has the molecular formula C29H32FN3O4S and a molecular weight of 537.66 g/mol. Its IUPAC name is 6-cyclopentyl-6-[2-(3-fluoro-4-propan-2-yloxyphenyl)ethyl]-3-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]oxane-2,4-dione.
| Compound Name | 6-cyclopentyl-6-[2-(3-fluoro-4-propan-2-yloxyphenyl)ethyl]-3-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]oxane-2,4-dione |
|---|---|
| PubChem CID | 91040624 |
| Molecular Formula | C29H32FN3O4S |
| Molecular Weight | 537.66 g/mol |
| Exact Mass | 537.21 |
| IUPAC Name | 6-cyclopentyl-6-[2-(3-fluoro-4-propan-2-yloxyphenyl)ethyl]-3-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]oxane-2,4-dione |
| SMILES | CC(C)Oc1ccc(CCC2(C3CCCC3)CC(=O)C(Sc3n[nH]c(-c4ccccc4)n3)C(=O)O2)cc1F |
| InChI | InChI=1S/C29H32FN3O4S/c1-18(2)36-24-13-12-19(16-22(24)30)14-15-29(21-10-6-7-11-21)17-23(34)25(27(35)37-29)38-28-31-26(32-33-28)20-8-4-3-5-9-20/h3-5,8-9,12-13,16,18,21,25H,6-7,10-11,14-15,17H2,1-2H3,(H,31,32,33) |
| InChIKey | JXUCLGSUGDGGHM-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.66 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|