C24H26O2 — CID 91040825
(1S,5R)-3-[2-methyl-5-(2,4,6-trimethylphenyl)phenyl]bicyclo[3.2.1]octane-2,4-dione (PubChem CID 91040825) has the molecular formula C24H26O2 and a molecular weight of 346.47 g/mol. Its IUPAC name is (1S,5R)-3-[2-methyl-5-(2,4,6-trimethylphenyl)phenyl]bicyclo[3.2.1]octane-2,4-dione.
| Compound Name | (1S,5R)-3-[2-methyl-5-(2,4,6-trimethylphenyl)phenyl]bicyclo[3.2.1]octane-2,4-dione |
|---|---|
| PubChem CID | 91040825 |
| Molecular Formula | C24H26O2 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | (1S,5R)-3-[2-methyl-5-(2,4,6-trimethylphenyl)phenyl]bicyclo[3.2.1]octane-2,4-dione |
| SMILES | Cc1cc(C)c(-c2ccc(C)c(C3C(=O)[C@@H]4CC[C@@H](C4)C3=O)c2)c(C)c1 |
| InChI | InChI=1S/C24H26O2/c1-13-9-15(3)21(16(4)10-13)17-6-5-14(2)20(12-17)22-23(25)18-7-8-19(11-18)24(22)26/h5-6,9-10,12,18-19,22H,7-8,11H2,1-4H3/t18-,19+,22? |
| InChIKey | OPIFHJSYKLOGOF-QIDMFYOTSA-N |
| XLogP | 5.24 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|