C15H24N6O4S — CID 91040863
4-[(2,4-dimethyl-1,2,4-triazol-4-ium-3-yl)diazenyl]-N,N-diethylaniline;methanesulfonoperoxoate (PubChem CID 91040863) has the molecular formula C15H24N6O4S and a molecular weight of 384.46 g/mol. Its IUPAC name is 4-[(2,4-dimethyl-1,2,4-triazol-4-ium-3-yl)diazenyl]-N,N-diethylaniline;methanesulfonoperoxoate.
| Compound Name | 4-[(2,4-dimethyl-1,2,4-triazol-4-ium-3-yl)diazenyl]-N,N-diethylaniline;methanesulfonoperoxoate |
|---|---|
| PubChem CID | 91040863 |
| Molecular Formula | C15H24N6O4S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 4-[(2,4-dimethyl-1,2,4-triazol-4-ium-3-yl)diazenyl]-N,N-diethylaniline;methanesulfonoperoxoate |
| SMILES | CCN(CC)c1ccc(/N=N/c2n(C)nc[n+]2C)cc1.CS(=O)(=O)O[O-] |
| InChI | InChI=1S/C14H21N6.CH4O4S/c1-5-20(6-2)13-9-7-12(8-10-13)16-17-14-18(3)11-15-19(14)4;1-6(3,4)5-2/h7-11H,5-6H2,1-4H3;2H,1H3/q+1;/p-1 |
| InChIKey | JBSTXCHQEPCERB-UHFFFAOYSA-M |
| XLogP | 0.74 |
| TPSA | 116.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|