C12H21F3NO+ — CID 91041002
methoxy-dimethyl-(6,6,6-trifluoro-2-propan-2-ylhexa-1,3-dienyl)azanium (PubChem CID 91041002) has the molecular formula C12H21F3NO+ and a molecular weight of 252.30 g/mol. Its IUPAC name is methoxy-dimethyl-(6,6,6-trifluoro-2-propan-2-ylhexa-1,3-dienyl)azanium.
| Compound Name | methoxy-dimethyl-(6,6,6-trifluoro-2-propan-2-ylhexa-1,3-dienyl)azanium |
|---|---|
| PubChem CID | 91041002 |
| Molecular Formula | C12H21F3NO+ |
| Molecular Weight | 252.30 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | methoxy-dimethyl-(6,6,6-trifluoro-2-propan-2-ylhexa-1,3-dienyl)azanium |
| SMILES | CO[N+](C)(C)C=C(C=CCC(F)(F)F)C(C)C |
| InChI | InChI=1S/C12H21F3NO/c1-10(2)11(9-16(3,4)17-5)7-6-8-12(13,14)15/h6-7,9-10H,8H2,1-5H3/q+1 |
| InChIKey | CCPASRRZAPNFHB-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.30 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|