About 1-(2,4-diaminobutanoyl)piperidin-1-ium-1-carboxamide
1-(2,4-diaminobutanoyl)piperidin-1-ium-1-carboxamide (PubChem CID 91041224) has the molecular formula C10H21N4O2+
and a molecular weight of 229.30 g/mol. Its IUPAC name is 1-(2,4-diaminobutanoyl)piperidin-1-ium-1-carboxamide.
Molecular Properties
| Compound Name | 1-(2,4-diaminobutanoyl)piperidin-1-ium-1-carboxamide |
| PubChem CID | 91041224 |
| Molecular Formula | C10H21N4O2+ |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.17 |
| IUPAC Name | 1-(2,4-diaminobutanoyl)piperidin-1-ium-1-carboxamide |
| SMILES | NCCC(N)C(=O)[N+]1(C(N)=O)CCCCC1 |
| InChI | InChI=1S/C10H20N4O2/c11-5-4-8(12)9(15)14(10(13)16)6-2-1-3-7-14/h8H,1-7,11-12H2,(H-,13,16)/p+1 |
| InChIKey | WWSYUWYMZVLXPB-UHFFFAOYSA-O |
| XLogP | -0.73 |
| TPSA | 112.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,4-diaminobutanoyl)piperidin-1-ium-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,4-diaminobutanoyl)piperidin-1-ium-1-carboxamide?
The IUPAC name of 1-(2,4-diaminobutanoyl)piperidin-1-ium-1-carboxamide (CID 91041224) is 1-(2,4-diaminobutanoyl)piperidin-1-ium-1-carboxamide.
What is the SMILES notation for 1-(2,4-diaminobutanoyl)piperidin-1-ium-1-carboxamide?
The canonical SMILES for 1-(2,4-diaminobutanoyl)piperidin-1-ium-1-carboxamide is NCCC(N)C(=O)[N+]1(C(N)=O)CCCCC1.
What is the InChIKey of 1-(2,4-diaminobutanoyl)piperidin-1-ium-1-carboxamide?
The InChIKey is WWSYUWYMZVLXPB-UHFFFAOYSA-O. The full InChI is InChI=1S/C10H20N4O2/c11-5-4-8(12)9(15)14(10(13)16)6-2-1-3-7-14/h8H,1-7,11-12H2,(H-,13,16)/p+1.
What are the key properties of 1-(2,4-diaminobutanoyl)piperidin-1-ium-1-carboxamide?
1-(2,4-diaminobutanoyl)piperidin-1-ium-1-carboxamide has a molecular weight of 229.30 g/mol, XLogP of -0.73, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,4-diaminobutanoyl)piperidin-1-ium-1-carboxamide is sourced from PubChem (CID 91041224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).