C22H34O4 — CID 91041712
4-(1-hydroxy-4-methylpent-3-enyl)-4-methyl-2-(3-methylbutanoyl)-5-(3-methylbut-2-enyl)cyclopentane-1,3-dione (PubChem CID 91041712) has the molecular formula C22H34O4 and a molecular weight of 362.51 g/mol. Its IUPAC name is 4-(1-hydroxy-4-methylpent-3-enyl)-4-methyl-2-(3-methylbutanoyl)-5-(3-methylbut-2-enyl)cyclopentane-1,3-dione.
| Compound Name | 4-(1-hydroxy-4-methylpent-3-enyl)-4-methyl-2-(3-methylbutanoyl)-5-(3-methylbut-2-enyl)cyclopentane-1,3-dione |
|---|---|
| PubChem CID | 91041712 |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | 4-(1-hydroxy-4-methylpent-3-enyl)-4-methyl-2-(3-methylbutanoyl)-5-(3-methylbut-2-enyl)cyclopentane-1,3-dione |
| SMILES | CC(C)=CCC(O)C1(C)C(=O)C(C(=O)CC(C)C)C(=O)C1CC=C(C)C |
| InChI | InChI=1S/C22H34O4/c1-13(2)8-10-16-20(25)19(17(23)12-15(5)6)21(26)22(16,7)18(24)11-9-14(3)4/h8-9,15-16,18-19,24H,10-12H2,1-7H3 |
| InChIKey | HAAHCINHFAKTFY-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|