C20H19F3N2O3 — CID 9104185
phenacyl 1-[5-(trifluoromethyl)-2-pyridinyl]piperidine-4-carboxylate (PubChem CID 9104185) has the molecular formula C20H19F3N2O3 and a molecular weight of 392.38 g/mol. Its IUPAC name is phenacyl 1-[5-(trifluoromethyl)-2-pyridinyl]piperidine-4-carboxylate.
| Compound Name | phenacyl 1-[5-(trifluoromethyl)-2-pyridinyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 9104185 |
| Molecular Formula | C20H19F3N2O3 |
| Molecular Weight | 392.38 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | phenacyl 1-[5-(trifluoromethyl)-2-pyridinyl]piperidine-4-carboxylate |
| SMILES | O=C(COC(=O)C1CCN(c2ccc(C(F)(F)F)cn2)CC1)c1ccccc1 |
| InChI | InChI=1S/C20H19F3N2O3/c21-20(22,23)16-6-7-18(24-12-16)25-10-8-15(9-11-25)19(27)28-13-17(26)14-4-2-1-3-5-14/h1-7,12,15H,8-11,13H2 |
| InChIKey | NGLHOHRXVCPRLO-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.38 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |