C20H28O7 — CID 91042206
[(9R,12S)-1,13-dihydroxy-2,12-dimethyl-8-methylidene-5-oxo-6,15-dioxatricyclo[10.2.1.04,9]pentadec-2-en-10-yl] 2-methylpropanoate (PubChem CID 91042206) has the molecular formula C20H28O7 and a molecular weight of 380.44 g/mol. Its IUPAC name is [(9R,12S)-1,13-dihydroxy-2,12-dimethyl-8-methylidene-5-oxo-6,15-dioxatricyclo[10.2.1.04,9]pentadec-2-en-10-yl] 2-methylpropanoate.
| Compound Name | [(9R,12S)-1,13-dihydroxy-2,12-dimethyl-8-methylidene-5-oxo-6,15-dioxatricyclo[10.2.1.04,9]pentadec-2-en-10-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 91042206 |
| Molecular Formula | C20H28O7 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | [(9R,12S)-1,13-dihydroxy-2,12-dimethyl-8-methylidene-5-oxo-6,15-dioxatricyclo[10.2.1.04,9]pentadec-2-en-10-yl] 2-methylpropanoate |
| SMILES | C=C1COC(=O)C2C=C(C)C3(O)CC(O)[C@](C)(CC(OC(=O)C(C)C)[C@@H]12)O3 |
| InChI | InChI=1S/C20H28O7/c1-10(2)17(22)26-14-7-19(5)15(21)8-20(24,27-19)12(4)6-13-16(14)11(3)9-25-18(13)23/h6,10,13-16,21,24H,3,7-9H2,1-2,4-5H3/t13?,14?,15?,16-,19-,20?/m0/s1 |
| InChIKey | XVPQWVLZPJDNFS-PNGPSFQMSA-N |
| XLogP | 1.48 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|