About ethane;N'-hydroxyethanimidamide
ethane;N'-hydroxyethanimidamide (PubChem CID 91042978) has the molecular formula C4H12N2O
and a molecular weight of 104.15 g/mol. Its IUPAC name is ethane;N'-hydroxyethanimidamide.
Molecular Properties
| Compound Name | ethane;N'-hydroxyethanimidamide |
| PubChem CID | 91042978 |
| Molecular Formula | C4H12N2O |
| Molecular Weight | 104.15 g/mol |
| Exact Mass | 104.09 |
| IUPAC Name | ethane;N'-hydroxyethanimidamide |
| SMILES | C/C(N)=N\O.CC |
| InChI | InChI=1S/C2H6N2O.C2H6/c1-2(3)4-5;1-2/h5H,1H3,(H2,3,4);1-2H3 |
| InChIKey | CFRYHROHYHQEEC-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 104.15 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;N'-hydroxyethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N'-hydroxyethanimidamide?
The IUPAC name of ethane;N'-hydroxyethanimidamide (CID 91042978) is ethane;N'-hydroxyethanimidamide.
What is the SMILES notation for ethane;N'-hydroxyethanimidamide?
The canonical SMILES for ethane;N'-hydroxyethanimidamide is C/C(N)=N\O.CC.
What is the InChIKey of ethane;N'-hydroxyethanimidamide?
The InChIKey is CFRYHROHYHQEEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6N2O.C2H6/c1-2(3)4-5;1-2/h5H,1H3,(H2,3,4);1-2H3.
What are the key properties of ethane;N'-hydroxyethanimidamide?
ethane;N'-hydroxyethanimidamide has a molecular weight of 104.15 g/mol, XLogP of 0.78, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N'-hydroxyethanimidamide is sourced from PubChem (CID 91042978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).