C22H29NO — CID 91043214
2-[[(8R,9S,10R,13R,14S,17S)-13-methyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]methyl]prop-2-enenitrile (PubChem CID 91043214) has the molecular formula C22H29NO and a molecular weight of 323.48 g/mol. Its IUPAC name is 2-[[(8R,9S,10R,13R,14S,17S)-13-methyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]methyl]prop-2-enenitrile.
| Compound Name | 2-[[(8R,9S,10R,13R,14S,17S)-13-methyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]methyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 91043214 |
| Molecular Formula | C22H29NO |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.22 |
| IUPAC Name | 2-[[(8R,9S,10R,13R,14S,17S)-13-methyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]methyl]prop-2-enenitrile |
| SMILES | C=C(C#N)C[C@@H]1CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@@H]4[C@H]3CC[C@]12C |
| InChI | InChI=1S/C22H29NO/c1-14(13-23)11-16-4-8-21-20-6-3-15-12-17(24)5-7-18(15)19(20)9-10-22(16,21)2/h12,16,18-21H,1,3-11H2,2H3/t16-,18-,19+,20+,21-,22+/m0/s1 |
| InChIKey | DGYKDFQIYVLMLK-ZTRCUUGNSA-N |
| XLogP | 5.21 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|