C15H13ClN3O3+ — CID 91043431
ethyl 14-chloro-9-oxo-7,10-diaza-5-azoniatetracyclo[9.4.0.03,5.04,8]pentadeca-1(11),5,7,12,14-pentaene-6-carboxylate (PubChem CID 91043431) has the molecular formula C15H13ClN3O3+ and a molecular weight of 318.74 g/mol. Its IUPAC name is ethyl 14-chloro-9-oxo-7,10-diaza-5-azoniatetracyclo[9.4.0.03,5.04,8]pentadeca-1(11),5,7,12,14-pentaene-6-carboxylate.
| Compound Name | ethyl 14-chloro-9-oxo-7,10-diaza-5-azoniatetracyclo[9.4.0.03,5.04,8]pentadeca-1(11),5,7,12,14-pentaene-6-carboxylate |
|---|---|
| PubChem CID | 91043431 |
| Molecular Formula | C15H13ClN3O3+ |
| Molecular Weight | 318.74 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | ethyl 14-chloro-9-oxo-7,10-diaza-5-azoniatetracyclo[9.4.0.03,5.04,8]pentadeca-1(11),5,7,12,14-pentaene-6-carboxylate |
| SMILES | CCOC(=O)C1=[N+]2C3Cc4cc(Cl)ccc4NC(=O)C(=N1)C32 |
| InChI | InChI=1S/C15H12ClN3O3/c1-2-22-15(21)13-18-11-12-10(19(12)13)6-7-5-8(16)3-4-9(7)17-14(11)20/h3-5,10,12H,2,6H2,1H3/p+1 |
| InChIKey | OZKPOCDXISNHGX-UHFFFAOYSA-O |
| XLogP | 1.01 |
| TPSA | 70.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.74 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|