C25H21N5O5S2 — CID 91043482
2-[4-[5-methyl-4-[(3-methyl-2,5-dioxopyrrol-1-yl)amino]-2-thiophen-2-ylthieno[2,3-d]pyrimidin-6-yl]phenoxy]ethylcarbamic acid (PubChem CID 91043482) has the molecular formula C25H21N5O5S2 and a molecular weight of 535.61 g/mol. Its IUPAC name is 2-[4-[5-methyl-4-[(3-methyl-2,5-dioxopyrrol-1-yl)amino]-2-thiophen-2-ylthieno[2,3-d]pyrimidin-6-yl]phenoxy]ethylcarbamic acid.
| Compound Name | 2-[4-[5-methyl-4-[(3-methyl-2,5-dioxopyrrol-1-yl)amino]-2-thiophen-2-ylthieno[2,3-d]pyrimidin-6-yl]phenoxy]ethylcarbamic acid |
|---|---|
| PubChem CID | 91043482 |
| Molecular Formula | C25H21N5O5S2 |
| Molecular Weight | 535.61 g/mol |
| Exact Mass | 535.10 |
| IUPAC Name | 2-[4-[5-methyl-4-[(3-methyl-2,5-dioxopyrrol-1-yl)amino]-2-thiophen-2-ylthieno[2,3-d]pyrimidin-6-yl]phenoxy]ethylcarbamic acid |
| SMILES | CC1=CC(=O)N(Nc2nc(-c3cccs3)nc3sc(-c4ccc(OCCNC(=O)O)cc4)c(C)c23)C1=O |
| InChI | InChI=1S/C25H21N5O5S2/c1-13-12-18(31)30(24(13)32)29-22-19-14(2)20(37-23(19)28-21(27-22)17-4-3-11-36-17)15-5-7-16(8-6-15)35-10-9-26-25(33)34/h3-8,11-12,26H,9-10H2,1-2H3,(H,33,34)(H,27,28,29) |
| InChIKey | CJWBIHBABDUFSV-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 133.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.61 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|