C11H9FN4O3 — CID 91043699
[4-(4-carbamoylpyrazol-1-yl)-3-fluorophenyl]carbamic acid (PubChem CID 91043699) has the molecular formula C11H9FN4O3 and a molecular weight of 264.22 g/mol. Its IUPAC name is [4-(4-carbamoylpyrazol-1-yl)-3-fluorophenyl]carbamic acid.
| Compound Name | [4-(4-carbamoylpyrazol-1-yl)-3-fluorophenyl]carbamic acid |
|---|---|
| PubChem CID | 91043699 |
| Molecular Formula | C11H9FN4O3 |
| Molecular Weight | 264.22 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | [4-(4-carbamoylpyrazol-1-yl)-3-fluorophenyl]carbamic acid |
| SMILES | NC(=O)c1cnn(-c2ccc(NC(=O)O)cc2F)c1 |
| InChI | InChI=1S/C11H9FN4O3/c12-8-3-7(15-11(18)19)1-2-9(8)16-5-6(4-14-16)10(13)17/h1-5,15H,(H2,13,17)(H,18,19) |
| InChIKey | WVLCMKLRSNOYPJ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.22 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |