C27H27ClF3N5O3 — CID 91044084
4-[4-[(5-chloro-2-ethoxyphenyl)carbamoylamino]phenyl]-N-[2-(trifluoromethyl)phenyl]piperazine-1-carboxamide (PubChem CID 91044084) has the molecular formula C27H27ClF3N5O3 and a molecular weight of 561.99 g/mol. Its IUPAC name is 4-[4-[(5-chloro-2-ethoxyphenyl)carbamoylamino]phenyl]-N-[2-(trifluoromethyl)phenyl]piperazine-1-carboxamide.
| Compound Name | 4-[4-[(5-chloro-2-ethoxyphenyl)carbamoylamino]phenyl]-N-[2-(trifluoromethyl)phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 91044084 |
| Molecular Formula | C27H27ClF3N5O3 |
| Molecular Weight | 561.99 g/mol |
| Exact Mass | 561.18 |
| IUPAC Name | 4-[4-[(5-chloro-2-ethoxyphenyl)carbamoylamino]phenyl]-N-[2-(trifluoromethyl)phenyl]piperazine-1-carboxamide |
| SMILES | CCOc1ccc(Cl)cc1NC(=O)Nc1ccc(N2CCN(C(=O)Nc3ccccc3C(F)(F)F)CC2)cc1 |
| InChI | InChI=1S/C27H27ClF3N5O3/c1-2-39-24-12-7-18(28)17-23(24)33-25(37)32-19-8-10-20(11-9-19)35-13-15-36(16-14-35)26(38)34-22-6-4-3-5-21(22)27(29,30)31/h3-12,17H,2,13-16H2,1H3,(H,34,38)(H2,32,33,37) |
| InChIKey | MVIZMJVPVQEUSE-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.99 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|