About 1H-pyrazole-3,5-dicarbohydrazide
1H-pyrazole-3,5-dicarbohydrazide (PubChem CID 91044122) has the molecular formula C5H8N6O2
and a molecular weight of 184.16 g/mol. Its IUPAC name is 1H-pyrazole-3,5-dicarbohydrazide.
Molecular Properties
| Compound Name | 1H-pyrazole-3,5-dicarbohydrazide |
| PubChem CID | 91044122 |
| Molecular Formula | C5H8N6O2 |
| Molecular Weight | 184.16 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 1H-pyrazole-3,5-dicarbohydrazide |
| SMILES | NNC(=O)c1cc(C(=O)NN)[nH]n1 |
| InChI | InChI=1S/C5H8N6O2/c6-8-4(12)2-1-3(11-10-2)5(13)9-7/h1H,6-7H2,(H,8,12)(H,9,13)(H,10,11) |
| InChIKey | XOAXKUJQRYTQRS-UHFFFAOYSA-N |
| XLogP | -2.38 |
| TPSA | 138.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.16 |
| LogP ≤ 5 | -2.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1H-pyrazole-3,5-dicarbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyrazole-3,5-dicarbohydrazide?
The IUPAC name of 1H-pyrazole-3,5-dicarbohydrazide (CID 91044122) is 1H-pyrazole-3,5-dicarbohydrazide.
What is the SMILES notation for 1H-pyrazole-3,5-dicarbohydrazide?
The canonical SMILES for 1H-pyrazole-3,5-dicarbohydrazide is NNC(=O)c1cc(C(=O)NN)[nH]n1.
What is the InChIKey of 1H-pyrazole-3,5-dicarbohydrazide?
The InChIKey is XOAXKUJQRYTQRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N6O2/c6-8-4(12)2-1-3(11-10-2)5(13)9-7/h1H,6-7H2,(H,8,12)(H,9,13)(H,10,11).
What are the key properties of 1H-pyrazole-3,5-dicarbohydrazide?
1H-pyrazole-3,5-dicarbohydrazide has a molecular weight of 184.16 g/mol, XLogP of -2.38, 2 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrazole-3,5-dicarbohydrazide is sourced from PubChem (CID 91044122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).