About nona-1,3,6-trien-5-imine
nona-1,3,6-trien-5-imine (PubChem CID 91044279) has the molecular formula C9H13N
and a molecular weight of 135.21 g/mol. Its IUPAC name is nona-1,3,6-trien-5-imine.
Molecular Properties
| Compound Name | nona-1,3,6-trien-5-imine |
| PubChem CID | 91044279 |
| Molecular Formula | C9H13N |
| Molecular Weight | 135.21 g/mol |
| Exact Mass | 135.10 |
| IUPAC Name | nona-1,3,6-trien-5-imine |
| SMILES | [H]/N=C(\C=CC=C)C=CCC |
| InChI | InChI=1S/C9H13N/c1-3-5-7-9(10)8-6-4-2/h3,5-8,10H,1,4H2,2H3/b7-5?,8-6?,10-9+ |
| InChIKey | FWIVNXBSDKGYLV-ZYGFSQLWSA-N |
| XLogP | 2.71 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.21 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze nona-1,3,6-trien-5-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nona-1,3,6-trien-5-imine?
The IUPAC name of nona-1,3,6-trien-5-imine (CID 91044279) is nona-1,3,6-trien-5-imine.
What is the SMILES notation for nona-1,3,6-trien-5-imine?
The canonical SMILES for nona-1,3,6-trien-5-imine is [H]/N=C(\C=CC=C)C=CCC.
What is the InChIKey of nona-1,3,6-trien-5-imine?
The InChIKey is FWIVNXBSDKGYLV-ZYGFSQLWSA-N. The full InChI is InChI=1S/C9H13N/c1-3-5-7-9(10)8-6-4-2/h3,5-8,10H,1,4H2,2H3/b7-5?,8-6?,10-9+.
What are the key properties of nona-1,3,6-trien-5-imine?
nona-1,3,6-trien-5-imine has a molecular weight of 135.21 g/mol, XLogP of 2.71, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for nona-1,3,6-trien-5-imine is sourced from PubChem (CID 91044279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).