About 2-[4-(4-azido-2,6-difluorophenyl)piperazin-1-yl]acetonitrile
2-[4-(4-azido-2,6-difluorophenyl)piperazin-1-yl]acetonitrile (PubChem CID 91044481) has the molecular formula C12H12F2N6
and a molecular weight of 278.27 g/mol. Its IUPAC name is 2-[4-(4-azido-2,6-difluorophenyl)piperazin-1-yl]acetonitrile.
Molecular Properties
| Compound Name | 2-[4-(4-azido-2,6-difluorophenyl)piperazin-1-yl]acetonitrile |
| PubChem CID | 91044481 |
| Molecular Formula | C12H12F2N6 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 2-[4-(4-azido-2,6-difluorophenyl)piperazin-1-yl]acetonitrile |
| SMILES | N#CCN1CCN(c2c(F)cc(N=[N+]=[N-])cc2F)CC1 |
| InChI | InChI=1S/C12H12F2N6/c13-10-7-9(17-18-16)8-11(14)12(10)20-5-3-19(2-1-15)4-6-20/h7-8H,2-6H2 |
| InChIKey | HDRMAIGVNYDEEW-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 79.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(4-azido-2,6-difluorophenyl)piperazin-1-yl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(4-azido-2,6-difluorophenyl)piperazin-1-yl]acetonitrile?
The IUPAC name of 2-[4-(4-azido-2,6-difluorophenyl)piperazin-1-yl]acetonitrile (CID 91044481) is 2-[4-(4-azido-2,6-difluorophenyl)piperazin-1-yl]acetonitrile.
What is the SMILES notation for 2-[4-(4-azido-2,6-difluorophenyl)piperazin-1-yl]acetonitrile?
The canonical SMILES for 2-[4-(4-azido-2,6-difluorophenyl)piperazin-1-yl]acetonitrile is N#CCN1CCN(c2c(F)cc(N=[N+]=[N-])cc2F)CC1.
What is the InChIKey of 2-[4-(4-azido-2,6-difluorophenyl)piperazin-1-yl]acetonitrile?
The InChIKey is HDRMAIGVNYDEEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12F2N6/c13-10-7-9(17-18-16)8-11(14)12(10)20-5-3-19(2-1-15)4-6-20/h7-8H,2-6H2.
What are the key properties of 2-[4-(4-azido-2,6-difluorophenyl)piperazin-1-yl]acetonitrile?
2-[4-(4-azido-2,6-difluorophenyl)piperazin-1-yl]acetonitrile has a molecular weight of 278.27 g/mol, XLogP of 2.55, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(4-azido-2,6-difluorophenyl)piperazin-1-yl]acetonitrile is sourced from PubChem (CID 91044481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).