C31H50N7O9P — CID 91044766
[3-[[2-[[2-[(2-amino-4-methylpentanoyl)amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-[(2-methylpropan-2-yl)oxy]propanoyl]amino]-4-(methylamino)-4-oxobutan-2-yl] benzyl hydrogen phosphate (PubChem CID 91044766) has the molecular formula C31H50N7O9P and a molecular weight of 695.76 g/mol. Its IUPAC name is [3-[[2-[[2-[(2-amino-4-methylpentanoyl)amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-[(2-methylpropan-2-yl)oxy]propanoyl]amino]-4-(methylamino)-4-oxobutan-2-yl] benzyl hydrogen phosphate.
| Compound Name | [3-[[2-[[2-[(2-amino-4-methylpentanoyl)amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-[(2-methylpropan-2-yl)oxy]propanoyl]amino]-4-(methylamino)-4-oxobutan-2-yl] benzyl hydrogen phosphate |
|---|---|
| PubChem CID | 91044766 |
| Molecular Formula | C31H50N7O9P |
| Molecular Weight | 695.76 g/mol |
| Exact Mass | 695.34 |
| IUPAC Name | [3-[[2-[[2-[(2-amino-4-methylpentanoyl)amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-[(2-methylpropan-2-yl)oxy]propanoyl]amino]-4-(methylamino)-4-oxobutan-2-yl] benzyl hydrogen phosphate |
| SMILES | CNC(=O)C(NC(=O)C(COC(C)(C)C)NC(=O)C(Cc1cnc[nH]1)NC(=O)C(N)CC(C)C)C(C)OP(=O)(O)OCc1ccccc1 |
| InChI | InChI=1S/C31H50N7O9P/c1-19(2)13-23(32)27(39)36-24(14-22-15-34-18-35-22)28(40)37-25(17-45-31(4,5)6)29(41)38-26(30(42)33-7)20(3)47-48(43,44)46-16-21-11-9-8-10-12-21/h8-12,15,18-20,23-26H,13-14,16-17,32H2,1-7H3,(H,33,42)(H,34,35)(H,36,39)(H,37,40)(H,38,41)(H,43,44) |
| InChIKey | BHPHZBYJNUPWGR-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 236.09 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.76 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|