About 1-piperazin-1-yl-1,2,3,4-tetrahydroisoquinoline
1-piperazin-1-yl-1,2,3,4-tetrahydroisoquinoline (PubChem CID 91044952) has the molecular formula C13H19N3
and a molecular weight of 217.32 g/mol. Its IUPAC name is 1-piperazin-1-yl-1,2,3,4-tetrahydroisoquinoline.
Molecular Properties
| Compound Name | 1-piperazin-1-yl-1,2,3,4-tetrahydroisoquinoline |
| PubChem CID | 91044952 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | 1-piperazin-1-yl-1,2,3,4-tetrahydroisoquinoline |
| SMILES | c1ccc2c(c1)CCNC2N1CCNCC1 |
| InChI | InChI=1S/C13H19N3/c1-2-4-12-11(3-1)5-6-15-13(12)16-9-7-14-8-10-16/h1-4,13-15H,5-10H2 |
| InChIKey | STHCLEYMPYLFGL-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-piperazin-1-yl-1,2,3,4-tetrahydroisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-piperazin-1-yl-1,2,3,4-tetrahydroisoquinoline?
The IUPAC name of 1-piperazin-1-yl-1,2,3,4-tetrahydroisoquinoline (CID 91044952) is 1-piperazin-1-yl-1,2,3,4-tetrahydroisoquinoline.
What is the SMILES notation for 1-piperazin-1-yl-1,2,3,4-tetrahydroisoquinoline?
The canonical SMILES for 1-piperazin-1-yl-1,2,3,4-tetrahydroisoquinoline is c1ccc2c(c1)CCNC2N1CCNCC1.
What is the InChIKey of 1-piperazin-1-yl-1,2,3,4-tetrahydroisoquinoline?
The InChIKey is STHCLEYMPYLFGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3/c1-2-4-12-11(3-1)5-6-15-13(12)16-9-7-14-8-10-16/h1-4,13-15H,5-10H2.
What are the key properties of 1-piperazin-1-yl-1,2,3,4-tetrahydroisoquinoline?
1-piperazin-1-yl-1,2,3,4-tetrahydroisoquinoline has a molecular weight of 217.32 g/mol, XLogP of 0.74, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-piperazin-1-yl-1,2,3,4-tetrahydroisoquinoline is sourced from PubChem (CID 91044952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).