C28H34FN3S — CID 91045226
2-[5-(4-fluorophenyl)imino-6-methanimidoyl-7a-methyl-2,3,6,7-tetrahydro-1H-inden-1-yl]-1-phenyl-N-propan-2-ylsulfanylethanamine (PubChem CID 91045226) has the molecular formula C28H34FN3S and a molecular weight of 463.67 g/mol. Its IUPAC name is 2-[5-(4-fluorophenyl)imino-6-methanimidoyl-7a-methyl-2,3,6,7-tetrahydro-1H-inden-1-yl]-1-phenyl-N-propan-2-ylsulfanylethanamine.
| Compound Name | 2-[5-(4-fluorophenyl)imino-6-methanimidoyl-7a-methyl-2,3,6,7-tetrahydro-1H-inden-1-yl]-1-phenyl-N-propan-2-ylsulfanylethanamine |
|---|---|
| PubChem CID | 91045226 |
| Molecular Formula | C28H34FN3S |
| Molecular Weight | 463.67 g/mol |
| Exact Mass | 463.25 |
| IUPAC Name | 2-[5-(4-fluorophenyl)imino-6-methanimidoyl-7a-methyl-2,3,6,7-tetrahydro-1H-inden-1-yl]-1-phenyl-N-propan-2-ylsulfanylethanamine |
| SMILES | [H]/N=C/C1CC2(C)C(=C/C1=N\c1ccc(F)cc1)CCC2CC(NSC(C)C)c1ccccc1 |
| InChI | InChI=1S/C28H34FN3S/c1-19(2)33-32-27(20-7-5-4-6-8-20)16-23-10-9-22-15-26(21(18-30)17-28(22,23)3)31-25-13-11-24(29)12-14-25/h4-8,11-15,18-19,21,23,27,30,32H,9-10,16-17H2,1-3H3/b30-18+,31-26+ |
| InChIKey | JKOKBBONDHWBMI-HPZKLJPZSA-N |
| XLogP | 7.69 |
| TPSA | 48.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.67 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|