C15H14F3N7OS2 — CID 91045483
1-methyl-3-[2-(1,3-thiazol-4-yl)-2,3-dihydro-1H-benzimidazol-5-yl]-1-[5-(trifluoromethyl)-2,3-dihydro-1,3,4-thiadiazol-2-yl]urea (PubChem CID 91045483) has the molecular formula C15H14F3N7OS2 and a molecular weight of 429.45 g/mol. Its IUPAC name is 1-methyl-3-[2-(1,3-thiazol-4-yl)-2,3-dihydro-1H-benzimidazol-5-yl]-1-[5-(trifluoromethyl)-2,3-dihydro-1,3,4-thiadiazol-2-yl]urea.
| Compound Name | 1-methyl-3-[2-(1,3-thiazol-4-yl)-2,3-dihydro-1H-benzimidazol-5-yl]-1-[5-(trifluoromethyl)-2,3-dihydro-1,3,4-thiadiazol-2-yl]urea |
|---|---|
| PubChem CID | 91045483 |
| Molecular Formula | C15H14F3N7OS2 |
| Molecular Weight | 429.45 g/mol |
| Exact Mass | 429.07 |
| IUPAC Name | 1-methyl-3-[2-(1,3-thiazol-4-yl)-2,3-dihydro-1H-benzimidazol-5-yl]-1-[5-(trifluoromethyl)-2,3-dihydro-1,3,4-thiadiazol-2-yl]urea |
| SMILES | CN(C(=O)Nc1ccc2c(c1)NC(c1cscn1)N2)C1NN=C(C(F)(F)F)S1 |
| InChI | InChI=1S/C15H14F3N7OS2/c1-25(14-24-23-12(28-14)15(16,17)18)13(26)20-7-2-3-8-9(4-7)22-11(21-8)10-5-27-6-19-10/h2-6,11,14,21-22,24H,1H3,(H,20,26) |
| InChIKey | LXIROHUIWKYPRU-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 93.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.45 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |