C16H21NO4S — CID 91045569
3-[(4-methylphenyl)sulfonyl-prop-2-enylamino]hex-5-enoic acid (PubChem CID 91045569) has the molecular formula C16H21NO4S and a molecular weight of 323.41 g/mol. Its IUPAC name is 3-[(4-methylphenyl)sulfonyl-prop-2-enylamino]hex-5-enoic acid.
| Compound Name | 3-[(4-methylphenyl)sulfonyl-prop-2-enylamino]hex-5-enoic acid |
|---|---|
| PubChem CID | 91045569 |
| Molecular Formula | C16H21NO4S |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 3-[(4-methylphenyl)sulfonyl-prop-2-enylamino]hex-5-enoic acid |
| SMILES | C=CCC(CC(=O)O)N(CC=C)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H21NO4S/c1-4-6-14(12-16(18)19)17(11-5-2)22(20,21)15-9-7-13(3)8-10-15/h4-5,7-10,14H,1-2,6,11-12H2,3H3,(H,18,19) |
| InChIKey | AZACFVHHVCIXHG-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|