C22H25N5O2 — CID 91045884
ethyl 2-[bis[1-(1H-benzimidazol-2-yl)ethyl]amino]acetate (PubChem CID 91045884) has the molecular formula C22H25N5O2 and a molecular weight of 391.48 g/mol. Its IUPAC name is ethyl 2-[bis[1-(1H-benzimidazol-2-yl)ethyl]amino]acetate.
| Compound Name | ethyl 2-[bis[1-(1H-benzimidazol-2-yl)ethyl]amino]acetate |
|---|---|
| PubChem CID | 91045884 |
| Molecular Formula | C22H25N5O2 |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | ethyl 2-[bis[1-(1H-benzimidazol-2-yl)ethyl]amino]acetate |
| SMILES | CCOC(=O)CN(C(C)c1nc2ccccc2[nH]1)C(C)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C22H25N5O2/c1-4-29-20(28)13-27(14(2)21-23-16-9-5-6-10-17(16)24-21)15(3)22-25-18-11-7-8-12-19(18)26-22/h5-12,14-15H,4,13H2,1-3H3,(H,23,24)(H,25,26) |
| InChIKey | PKZIHJNBVUDDNM-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 86.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |